About 3-[(5-chloro-2,4-dimethoxyphenyl)-methylsulfamoyl]-N-(1,3-thiazol-2-yl)benzamide
3-[(5-chloro-2,4-dimethoxyphenyl)-methylsulfamoyl]-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 2120898) has the molecular formula C19H18ClN3O5S2
and a molecular weight of 467.96 g/mol. Its IUPAC name is 3-[(5-chloro-2,4-dimethoxyphenyl)-methylsulfamoyl]-N-(1,3-thiazol-2-yl)benzamide.
Molecular Properties
| Compound Name | 3-[(5-chloro-2,4-dimethoxyphenyl)-methylsulfamoyl]-N-(1,3-thiazol-2-yl)benzamide |
| PubChem CID | 2120898 |
| Molecular Formula | C19H18ClN3O5S2 |
| Molecular Weight | 467.96 g/mol |
| Exact Mass | 467.04 |
| IUPAC Name | 3-[(5-chloro-2,4-dimethoxyphenyl)-methylsulfamoyl]-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | COc1cc(OC)c(N(C)S(=O)(=O)c2cccc(C(=O)Nc3nccs3)c2)cc1Cl |
| InChI | InChI=1S/C19H18ClN3O5S2/c1-23(15-10-14(20)16(27-2)11-17(15)28-3)30(25,26)13-6-4-5-12(9-13)18(24)22-19-21-7-8-29-19/h4-11H,1-3H3,(H,21,22,24) |
| InChIKey | HTJXGUSJAXWKKE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 467.96 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[(5-chloro-2,4-dimethoxyphenyl)-methylsulfamoyl]-N-(1,3-thiazol-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-chloro-2,4-dimethoxyphenyl)-methylsulfamoyl]-N-(1,3-thiazol-2-yl)benzamide?
The IUPAC name of 3-[(5-chloro-2,4-dimethoxyphenyl)-methylsulfamoyl]-N-(1,3-thiazol-2-yl)benzamide (CID 2120898) is 3-[(5-chloro-2,4-dimethoxyphenyl)-methylsulfamoyl]-N-(1,3-thiazol-2-yl)benzamide.
What is the SMILES notation for 3-[(5-chloro-2,4-dimethoxyphenyl)-methylsulfamoyl]-N-(1,3-thiazol-2-yl)benzamide?
The canonical SMILES for 3-[(5-chloro-2,4-dimethoxyphenyl)-methylsulfamoyl]-N-(1,3-thiazol-2-yl)benzamide is COc1cc(OC)c(N(C)S(=O)(=O)c2cccc(C(=O)Nc3nccs3)c2)cc1Cl.
What is the InChIKey of 3-[(5-chloro-2,4-dimethoxyphenyl)-methylsulfamoyl]-N-(1,3-thiazol-2-yl)benzamide?
The InChIKey is HTJXGUSJAXWKKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18ClN3O5S2/c1-23(15-10-14(20)16(27-2)11-17(15)28-3)30(25,26)13-6-4-5-12(9-13)18(24)22-19-21-7-8-29-19/h4-11H,1-3H3,(H,21,22,24).
What are the key properties of 3-[(5-chloro-2,4-dimethoxyphenyl)-methylsulfamoyl]-N-(1,3-thiazol-2-yl)benzamide?
3-[(5-chloro-2,4-dimethoxyphenyl)-methylsulfamoyl]-N-(1,3-thiazol-2-yl)benzamide has a molecular weight of 467.96 g/mol, XLogP of 3.89, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-chloro-2,4-dimethoxyphenyl)-methylsulfamoyl]-N-(1,3-thiazol-2-yl)benzamide is sourced from PubChem (CID 2120898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).