About 2-oxopropyl pyrrolidine-1-carbodithioate
2-oxopropyl pyrrolidine-1-carbodithioate (PubChem CID 21209144) has the molecular formula C8H13NOS2
and a molecular weight of 203.33 g/mol. Its IUPAC name is 2-oxopropyl pyrrolidine-1-carbodithioate.
Molecular Properties
| Compound Name | 2-oxopropyl pyrrolidine-1-carbodithioate |
| PubChem CID | 21209144 |
| Molecular Formula | C8H13NOS2 |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.04 |
| IUPAC Name | 2-oxopropyl pyrrolidine-1-carbodithioate |
| SMILES | CC(=O)CSC(=S)N1CCCC1 |
| InChI | InChI=1S/C8H13NOS2/c1-7(10)6-12-8(11)9-4-2-3-5-9/h2-6H2,1H3 |
| InChIKey | JEVZPLUPTCODCO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-oxopropyl pyrrolidine-1-carbodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxopropyl pyrrolidine-1-carbodithioate?
The IUPAC name of 2-oxopropyl pyrrolidine-1-carbodithioate (CID 21209144) is 2-oxopropyl pyrrolidine-1-carbodithioate.
What is the SMILES notation for 2-oxopropyl pyrrolidine-1-carbodithioate?
The canonical SMILES for 2-oxopropyl pyrrolidine-1-carbodithioate is CC(=O)CSC(=S)N1CCCC1.
What is the InChIKey of 2-oxopropyl pyrrolidine-1-carbodithioate?
The InChIKey is JEVZPLUPTCODCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NOS2/c1-7(10)6-12-8(11)9-4-2-3-5-9/h2-6H2,1H3.
What are the key properties of 2-oxopropyl pyrrolidine-1-carbodithioate?
2-oxopropyl pyrrolidine-1-carbodithioate has a molecular weight of 203.33 g/mol, XLogP of 1.69, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxopropyl pyrrolidine-1-carbodithioate is sourced from PubChem (CID 21209144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).