About 2-[2-(dimethylamino)ethyl-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]ethanol chloride
2-[2-(dimethylamino)ethyl-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]ethanol chloride (PubChem CID 21209215) has the molecular formula C13H19ClN3O3S-
and a molecular weight of 332.83 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethyl-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]ethanol chloride.
Molecular Properties
| Compound Name | 2-[2-(dimethylamino)ethyl-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]ethanol chloride |
| PubChem CID | 21209215 |
| Molecular Formula | C13H19ClN3O3S- |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 2-[2-(dimethylamino)ethyl-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]ethanol chloride |
| SMILES | CN(C)CCN(CCO)C1=NS(=O)(=O)c2ccccc21.[Cl-] |
| InChI | InChI=1S/C13H19N3O3S.ClH/c1-15(2)7-8-16(9-10-17)13-11-5-3-4-6-12(11)20(18,19)14-13;/h3-6,17H,7-10H2,1-2H3;1H/p-1 |
| InChIKey | MKRNFWLTKBJFKF-UHFFFAOYSA-M |
| XLogP | -3.00 |
| TPSA | 73.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | -3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-(dimethylamino)ethyl-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]ethanol chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(dimethylamino)ethyl-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]ethanol chloride?
The IUPAC name of 2-[2-(dimethylamino)ethyl-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]ethanol chloride (CID 21209215) is 2-[2-(dimethylamino)ethyl-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]ethanol chloride.
What is the SMILES notation for 2-[2-(dimethylamino)ethyl-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]ethanol chloride?
The canonical SMILES for 2-[2-(dimethylamino)ethyl-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]ethanol chloride is CN(C)CCN(CCO)C1=NS(=O)(=O)c2ccccc21.[Cl-].
What is the InChIKey of 2-[2-(dimethylamino)ethyl-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]ethanol chloride?
The InChIKey is MKRNFWLTKBJFKF-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H19N3O3S.ClH/c1-15(2)7-8-16(9-10-17)13-11-5-3-4-6-12(11)20(18,19)14-13;/h3-6,17H,7-10H2,1-2H3;1H/p-1.
What are the key properties of 2-[2-(dimethylamino)ethyl-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]ethanol chloride?
2-[2-(dimethylamino)ethyl-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]ethanol chloride has a molecular weight of 332.83 g/mol, XLogP of -3.00, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(dimethylamino)ethyl-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]ethanol chloride is sourced from PubChem (CID 21209215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).