About 6-methylsulfinyl-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one
6-methylsulfinyl-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one (PubChem CID 21209713) has the molecular formula C9H9NO4S2
and a molecular weight of 259.31 g/mol. Its IUPAC name is 6-methylsulfinyl-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one.
Molecular Properties
| Compound Name | 6-methylsulfinyl-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one |
| PubChem CID | 21209713 |
| Molecular Formula | C9H9NO4S2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.00 |
| IUPAC Name | 6-methylsulfinyl-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one |
| SMILES | CS(=O)c1ccc2c(c1)NC(=O)CS2(=O)=O |
| InChI | InChI=1S/C9H9NO4S2/c1-15(12)6-2-3-8-7(4-6)10-9(11)5-16(8,13)14/h2-4H,5H2,1H3,(H,10,11) |
| InChIKey | YUTMIOIGHIHBOH-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methylsulfinyl-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylsulfinyl-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one?
The IUPAC name of 6-methylsulfinyl-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one (CID 21209713) is 6-methylsulfinyl-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one.
What is the SMILES notation for 6-methylsulfinyl-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one?
The canonical SMILES for 6-methylsulfinyl-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one is CS(=O)c1ccc2c(c1)NC(=O)CS2(=O)=O.
What is the InChIKey of 6-methylsulfinyl-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one?
The InChIKey is YUTMIOIGHIHBOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO4S2/c1-15(12)6-2-3-8-7(4-6)10-9(11)5-16(8,13)14/h2-4H,5H2,1H3,(H,10,11).
What are the key properties of 6-methylsulfinyl-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one?
6-methylsulfinyl-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one has a molecular weight of 259.31 g/mol, XLogP of 0.15, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylsulfinyl-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one is sourced from PubChem (CID 21209713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).