C20H26NO7P — CID 21210882
ethyl 4-[[diethoxyphosphoryl-(2,4-dihydroxyphenyl)methyl]amino]benzoate (PubChem CID 21210882) has the molecular formula C20H26NO7P and a molecular weight of 423.40 g/mol. Its IUPAC name is ethyl 4-[[diethoxyphosphoryl-(2,4-dihydroxyphenyl)methyl]amino]benzoate.
| Compound Name | ethyl 4-[[diethoxyphosphoryl-(2,4-dihydroxyphenyl)methyl]amino]benzoate |
|---|---|
| PubChem CID | 21210882 |
| Molecular Formula | C20H26NO7P |
| Molecular Weight | 423.40 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | ethyl 4-[[diethoxyphosphoryl-(2,4-dihydroxyphenyl)methyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(c2ccc(O)cc2O)P(=O)(OCC)OCC)cc1 |
| InChI | InChI=1S/C20H26NO7P/c1-4-26-20(24)14-7-9-15(10-8-14)21-19(29(25,27-5-2)28-6-3)17-12-11-16(22)13-18(17)23/h7-13,19,21-23H,4-6H2,1-3H3 |
| InChIKey | VKMAPZOMJXQPAL-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.40 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|