C30H30N4O6S2 — CID 21212069
2-[N-(benzenesulfonyl)anilino]-N-[2-[[2-[N-(benzenesulfonyl)anilino]acetyl]amino]ethyl]acetamide (PubChem CID 21212069) has the molecular formula C30H30N4O6S2 and a molecular weight of 606.73 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)anilino]-N-[2-[[2-[N-(benzenesulfonyl)anilino]acetyl]amino]ethyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)anilino]-N-[2-[[2-[N-(benzenesulfonyl)anilino]acetyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 21212069 |
| Molecular Formula | C30H30N4O6S2 |
| Molecular Weight | 606.73 g/mol |
| Exact Mass | 606.16 |
| IUPAC Name | 2-[N-(benzenesulfonyl)anilino]-N-[2-[[2-[N-(benzenesulfonyl)anilino]acetyl]amino]ethyl]acetamide |
| SMILES | O=C(CN(c1ccccc1)S(=O)(=O)c1ccccc1)NCCNC(=O)CN(c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C30H30N4O6S2/c35-29(23-33(25-13-5-1-6-14-25)41(37,38)27-17-9-3-10-18-27)31-21-22-32-30(36)24-34(26-15-7-2-8-16-26)42(39,40)28-19-11-4-12-20-28/h1-20H,21-24H2,(H,31,35)(H,32,36) |
| InChIKey | KLESLWSCDITWLR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.73 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|