About N-butyl-N'-[2-(cyclohexen-1-yl)ethyl]oxamide
N-butyl-N'-[2-(cyclohexen-1-yl)ethyl]oxamide (PubChem CID 21212892) has the molecular formula C14H24N2O2
and a molecular weight of 252.36 g/mol. Its IUPAC name is N-butyl-N'-[2-(cyclohexen-1-yl)ethyl]oxamide.
Molecular Properties
| Compound Name | N-butyl-N'-[2-(cyclohexen-1-yl)ethyl]oxamide |
| PubChem CID | 21212892 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | N-butyl-N'-[2-(cyclohexen-1-yl)ethyl]oxamide |
| SMILES | CCCCNC(=O)C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C14H24N2O2/c1-2-3-10-15-13(17)14(18)16-11-9-12-7-5-4-6-8-12/h7H,2-6,8-11H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | SPXPDERNUYVOPH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-N'-[2-(cyclohexen-1-yl)ethyl]oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N'-[2-(cyclohexen-1-yl)ethyl]oxamide?
The IUPAC name of N-butyl-N'-[2-(cyclohexen-1-yl)ethyl]oxamide (CID 21212892) is N-butyl-N'-[2-(cyclohexen-1-yl)ethyl]oxamide.
What is the SMILES notation for N-butyl-N'-[2-(cyclohexen-1-yl)ethyl]oxamide?
The canonical SMILES for N-butyl-N'-[2-(cyclohexen-1-yl)ethyl]oxamide is CCCCNC(=O)C(=O)NCCC1=CCCCC1.
What is the InChIKey of N-butyl-N'-[2-(cyclohexen-1-yl)ethyl]oxamide?
The InChIKey is SPXPDERNUYVOPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2O2/c1-2-3-10-15-13(17)14(18)16-11-9-12-7-5-4-6-8-12/h7H,2-6,8-11H2,1H3,(H,15,17)(H,16,18).
What are the key properties of N-butyl-N'-[2-(cyclohexen-1-yl)ethyl]oxamide?
N-butyl-N'-[2-(cyclohexen-1-yl)ethyl]oxamide has a molecular weight of 252.36 g/mol, XLogP of 1.91, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N'-[2-(cyclohexen-1-yl)ethyl]oxamide is sourced from PubChem (CID 21212892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).