C10H7F3N2OS — CID 21215153
2-benzylsulfanyl-5-(trifluoromethyl)-1,3,4-oxadiazole (PubChem CID 21215153) has the molecular formula C10H7F3N2OS and a molecular weight of 260.24 g/mol. Its IUPAC name is 2-benzylsulfanyl-5-(trifluoromethyl)-1,3,4-oxadiazole.
| Compound Name | 2-benzylsulfanyl-5-(trifluoromethyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 21215153 |
| Molecular Formula | C10H7F3N2OS |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | 2-benzylsulfanyl-5-(trifluoromethyl)-1,3,4-oxadiazole |
| SMILES | FC(F)(F)c1nnc(SCc2ccccc2)o1 |
| InChI | InChI=1S/C10H7F3N2OS/c11-10(12,13)8-14-15-9(16-8)17-6-7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | RPQUXUYPLYQOBA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |