C13H10I2N2O3S — CID 21215560
5-[(4-hydroxy-3,5-diiodophenyl)methylidene]-1,3-dimethyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 21215560) has the molecular formula C13H10I2N2O3S and a molecular weight of 528.11 g/mol. Its IUPAC name is 5-[(4-hydroxy-3,5-diiodophenyl)methylidene]-1,3-dimethyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[(4-hydroxy-3,5-diiodophenyl)methylidene]-1,3-dimethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 21215560 |
| Molecular Formula | C13H10I2N2O3S |
| Molecular Weight | 528.11 g/mol |
| Exact Mass | 527.85 |
| IUPAC Name | 5-[(4-hydroxy-3,5-diiodophenyl)methylidene]-1,3-dimethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CN1C(=O)C(=Cc2cc(I)c(O)c(I)c2)C(=O)N(C)C1=S |
| InChI | InChI=1S/C13H10I2N2O3S/c1-16-11(19)7(12(20)17(2)13(16)21)3-6-4-8(14)10(18)9(15)5-6/h3-5,18H,1-2H3 |
| InChIKey | OOLAMXMKVHZMCW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.11 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|