About N-(4-amino-1,2,5-oxadiazole-3-carboximidoyl)-2-fluoro-N-hydroxybenzamide
N-(4-amino-1,2,5-oxadiazole-3-carboximidoyl)-2-fluoro-N-hydroxybenzamide (PubChem CID 21216040) has the molecular formula C10H8FN5O3
and a molecular weight of 265.20 g/mol. Its IUPAC name is N-(4-amino-1,2,5-oxadiazole-3-carboximidoyl)-2-fluoro-N-hydroxybenzamide.
Molecular Properties
| Compound Name | N-(4-amino-1,2,5-oxadiazole-3-carboximidoyl)-2-fluoro-N-hydroxybenzamide |
| PubChem CID | 21216040 |
| Molecular Formula | C10H8FN5O3 |
| Molecular Weight | 265.20 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | N-(4-amino-1,2,5-oxadiazole-3-carboximidoyl)-2-fluoro-N-hydroxybenzamide |
| SMILES | [H]/N=C(\c1nonc1N)N(O)C(=O)c1ccccc1F |
| InChI | InChI=1S/C10H8FN5O3/c11-6-4-2-1-3-5(6)10(17)16(18)9(13)7-8(12)15-19-14-7/h1-4,13,18H,(H2,12,15)/b13-9+ |
| InChIKey | LZRRBIDKFVGHGH-UKTHLTGXSA-N |
| XLogP | 0.65 |
| TPSA | 129.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.20 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(4-amino-1,2,5-oxadiazole-3-carboximidoyl)-2-fluoro-N-hydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-amino-1,2,5-oxadiazole-3-carboximidoyl)-2-fluoro-N-hydroxybenzamide?
The IUPAC name of N-(4-amino-1,2,5-oxadiazole-3-carboximidoyl)-2-fluoro-N-hydroxybenzamide (CID 21216040) is N-(4-amino-1,2,5-oxadiazole-3-carboximidoyl)-2-fluoro-N-hydroxybenzamide.
What is the SMILES notation for N-(4-amino-1,2,5-oxadiazole-3-carboximidoyl)-2-fluoro-N-hydroxybenzamide?
The canonical SMILES for N-(4-amino-1,2,5-oxadiazole-3-carboximidoyl)-2-fluoro-N-hydroxybenzamide is [H]/N=C(\c1nonc1N)N(O)C(=O)c1ccccc1F.
What is the InChIKey of N-(4-amino-1,2,5-oxadiazole-3-carboximidoyl)-2-fluoro-N-hydroxybenzamide?
The InChIKey is LZRRBIDKFVGHGH-UKTHLTGXSA-N. The full InChI is InChI=1S/C10H8FN5O3/c11-6-4-2-1-3-5(6)10(17)16(18)9(13)7-8(12)15-19-14-7/h1-4,13,18H,(H2,12,15)/b13-9+.
What are the key properties of N-(4-amino-1,2,5-oxadiazole-3-carboximidoyl)-2-fluoro-N-hydroxybenzamide?
N-(4-amino-1,2,5-oxadiazole-3-carboximidoyl)-2-fluoro-N-hydroxybenzamide has a molecular weight of 265.20 g/mol, XLogP of 0.65, 2 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-amino-1,2,5-oxadiazole-3-carboximidoyl)-2-fluoro-N-hydroxybenzamide is sourced from PubChem (CID 21216040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).