About 1-(2,1,3-benzoselenadiazol-5-yl)ethanone
1-(2,1,3-benzoselenadiazol-5-yl)ethanone (PubChem CID 21216050) has the molecular formula C8H6N2OSe
and a molecular weight of 225.11 g/mol. Its IUPAC name is 1-(2,1,3-benzoselenadiazol-5-yl)ethanone.
Molecular Properties
| Compound Name | 1-(2,1,3-benzoselenadiazol-5-yl)ethanone |
| PubChem CID | 21216050 |
| Molecular Formula | C8H6N2OSe |
| Molecular Weight | 225.11 g/mol |
| Exact Mass | 225.96 |
| IUPAC Name | 1-(2,1,3-benzoselenadiazol-5-yl)ethanone |
| SMILES | CC(=O)c1ccc2n[se]nc2c1 |
| InChI | InChI=1S/C8H6N2OSe/c1-5(11)6-2-3-7-8(4-6)10-12-9-7/h2-4H,1H3 |
| InChIKey | ZABVVQLYWDNKHA-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.11 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,1,3-benzoselenadiazol-5-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,1,3-benzoselenadiazol-5-yl)ethanone?
The IUPAC name of 1-(2,1,3-benzoselenadiazol-5-yl)ethanone (CID 21216050) is 1-(2,1,3-benzoselenadiazol-5-yl)ethanone.
What is the SMILES notation for 1-(2,1,3-benzoselenadiazol-5-yl)ethanone?
The canonical SMILES for 1-(2,1,3-benzoselenadiazol-5-yl)ethanone is CC(=O)c1ccc2n[se]nc2c1.
What is the InChIKey of 1-(2,1,3-benzoselenadiazol-5-yl)ethanone?
The InChIKey is ZABVVQLYWDNKHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2OSe/c1-5(11)6-2-3-7-8(4-6)10-12-9-7/h2-4H,1H3.
What are the key properties of 1-(2,1,3-benzoselenadiazol-5-yl)ethanone?
1-(2,1,3-benzoselenadiazol-5-yl)ethanone has a molecular weight of 225.11 g/mol, XLogP of 0.89, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,1,3-benzoselenadiazol-5-yl)ethanone is sourced from PubChem (CID 21216050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).