About 4-methoxy-3,5-dimethyl-2-(pyridin-2-ylsulfinylmethyl)aniline
4-methoxy-3,5-dimethyl-2-(pyridin-2-ylsulfinylmethyl)aniline (PubChem CID 21216751) has the molecular formula C15H18N2O2S
and a molecular weight of 290.39 g/mol. Its IUPAC name is 4-methoxy-3,5-dimethyl-2-(pyridin-2-ylsulfinylmethyl)aniline.
Molecular Properties
| Compound Name | 4-methoxy-3,5-dimethyl-2-(pyridin-2-ylsulfinylmethyl)aniline |
| PubChem CID | 21216751 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 4-methoxy-3,5-dimethyl-2-(pyridin-2-ylsulfinylmethyl)aniline |
| SMILES | COc1c(C)cc(N)c(CS(=O)c2ccccn2)c1C |
| InChI | InChI=1S/C15H18N2O2S/c1-10-8-13(16)12(11(2)15(10)19-3)9-20(18)14-6-4-5-7-17-14/h4-8H,9,16H2,1-3H3 |
| InChIKey | MHBOVPQVLVEMLD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-3,5-dimethyl-2-(pyridin-2-ylsulfinylmethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-3,5-dimethyl-2-(pyridin-2-ylsulfinylmethyl)aniline?
The IUPAC name of 4-methoxy-3,5-dimethyl-2-(pyridin-2-ylsulfinylmethyl)aniline (CID 21216751) is 4-methoxy-3,5-dimethyl-2-(pyridin-2-ylsulfinylmethyl)aniline.
What is the SMILES notation for 4-methoxy-3,5-dimethyl-2-(pyridin-2-ylsulfinylmethyl)aniline?
The canonical SMILES for 4-methoxy-3,5-dimethyl-2-(pyridin-2-ylsulfinylmethyl)aniline is COc1c(C)cc(N)c(CS(=O)c2ccccn2)c1C.
What is the InChIKey of 4-methoxy-3,5-dimethyl-2-(pyridin-2-ylsulfinylmethyl)aniline?
The InChIKey is MHBOVPQVLVEMLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O2S/c1-10-8-13(16)12(11(2)15(10)19-3)9-20(18)14-6-4-5-7-17-14/h4-8H,9,16H2,1-3H3.
What are the key properties of 4-methoxy-3,5-dimethyl-2-(pyridin-2-ylsulfinylmethyl)aniline?
4-methoxy-3,5-dimethyl-2-(pyridin-2-ylsulfinylmethyl)aniline has a molecular weight of 290.39 g/mol, XLogP of 2.60, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-3,5-dimethyl-2-(pyridin-2-ylsulfinylmethyl)aniline is sourced from PubChem (CID 21216751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).