C25H21ClN4O3 — CID 21216828
3-(3-aminopropyl)-7-chloro-19-methoxy-23-methyl-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione (PubChem CID 21216828) has the molecular formula C25H21ClN4O3 and a molecular weight of 460.92 g/mol. Its IUPAC name is 3-(3-aminopropyl)-7-chloro-19-methoxy-23-methyl-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione.
| Compound Name | 3-(3-aminopropyl)-7-chloro-19-methoxy-23-methyl-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione |
|---|---|
| PubChem CID | 21216828 |
| Molecular Formula | C25H21ClN4O3 |
| Molecular Weight | 460.92 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | 3-(3-aminopropyl)-7-chloro-19-methoxy-23-methyl-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione |
| SMILES | COc1ccc2c(c1)c1c3c(c4c5cc(Cl)ccc5n(CCCN)c4c1n2C)C(=O)NC3=O |
| InChI | InChI=1S/C25H21ClN4O3/c1-29-16-7-5-13(33-2)11-15(16)18-20-21(25(32)28-24(20)31)19-14-10-12(26)4-6-17(14)30(9-3-8-27)23(19)22(18)29/h4-7,10-11H,3,8-9,27H2,1-2H3,(H,28,31,32) |
| InChIKey | QKDPHMTWTYNVTI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 91.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.92 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|