About diethyl 2,3-bis(4-fluorophenyl)-5-hexylbenzene-1,4-dicarboxylate
diethyl 2,3-bis(4-fluorophenyl)-5-hexylbenzene-1,4-dicarboxylate (PubChem CID 21217007) has the molecular formula C30H32F2O4
and a molecular weight of 494.58 g/mol. Its IUPAC name is diethyl 2,3-bis(4-fluorophenyl)-5-hexylbenzene-1,4-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 2,3-bis(4-fluorophenyl)-5-hexylbenzene-1,4-dicarboxylate |
| PubChem CID | 21217007 |
| Molecular Formula | C30H32F2O4 |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | diethyl 2,3-bis(4-fluorophenyl)-5-hexylbenzene-1,4-dicarboxylate |
| SMILES | CCCCCCc1cc(C(=O)OCC)c(-c2ccc(F)cc2)c(-c2ccc(F)cc2)c1C(=O)OCC |
| InChI | InChI=1S/C30H32F2O4/c1-4-7-8-9-10-22-19-25(29(33)35-5-2)26(20-11-15-23(31)16-12-20)27(28(22)30(34)36-6-3)21-13-17-24(32)18-14-21/h11-19H,4-10H2,1-3H3 |
| InChIKey | SOHRKBGAVRCJPG-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2,3-bis(4-fluorophenyl)-5-hexylbenzene-1,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2,3-bis(4-fluorophenyl)-5-hexylbenzene-1,4-dicarboxylate?
The IUPAC name of diethyl 2,3-bis(4-fluorophenyl)-5-hexylbenzene-1,4-dicarboxylate (CID 21217007) is diethyl 2,3-bis(4-fluorophenyl)-5-hexylbenzene-1,4-dicarboxylate.
What is the SMILES notation for diethyl 2,3-bis(4-fluorophenyl)-5-hexylbenzene-1,4-dicarboxylate?
The canonical SMILES for diethyl 2,3-bis(4-fluorophenyl)-5-hexylbenzene-1,4-dicarboxylate is CCCCCCc1cc(C(=O)OCC)c(-c2ccc(F)cc2)c(-c2ccc(F)cc2)c1C(=O)OCC.
What is the InChIKey of diethyl 2,3-bis(4-fluorophenyl)-5-hexylbenzene-1,4-dicarboxylate?
The InChIKey is SOHRKBGAVRCJPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H32F2O4/c1-4-7-8-9-10-22-19-25(29(33)35-5-2)26(20-11-15-23(31)16-12-20)27(28(22)30(34)36-6-3)21-13-17-24(32)18-14-21/h11-19H,4-10H2,1-3H3.
What are the key properties of diethyl 2,3-bis(4-fluorophenyl)-5-hexylbenzene-1,4-dicarboxylate?
diethyl 2,3-bis(4-fluorophenyl)-5-hexylbenzene-1,4-dicarboxylate has a molecular weight of 494.58 g/mol, XLogP of 7.78, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2,3-bis(4-fluorophenyl)-5-hexylbenzene-1,4-dicarboxylate is sourced from PubChem (CID 21217007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).