C18H18F3NO3 — CID 21217815
methyl 5-acetyl-1,2,6-trimethyl-4-(3,4,5-trifluorophenyl)-4H-pyridine-3-carboxylate (PubChem CID 21217815) has the molecular formula C18H18F3NO3 and a molecular weight of 353.34 g/mol. Its IUPAC name is methyl 5-acetyl-1,2,6-trimethyl-4-(3,4,5-trifluorophenyl)-4H-pyridine-3-carboxylate.
| Compound Name | methyl 5-acetyl-1,2,6-trimethyl-4-(3,4,5-trifluorophenyl)-4H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 21217815 |
| Molecular Formula | C18H18F3NO3 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | methyl 5-acetyl-1,2,6-trimethyl-4-(3,4,5-trifluorophenyl)-4H-pyridine-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(C)C(C)=C(C(C)=O)C1c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C18H18F3NO3/c1-8-14(10(3)23)16(11-6-12(19)17(21)13(20)7-11)15(18(24)25-5)9(2)22(8)4/h6-7,16H,1-5H3 |
| InChIKey | ITGPVQDZXXQREU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|