About 3,4-diaminobenzamide
3,4-diaminobenzamide (PubChem CID 21217843) has the molecular formula C7H9N3O
and a molecular weight of 151.17 g/mol. Its IUPAC name is 3,4-diaminobenzamide.
Molecular Properties
| Compound Name | 3,4-diaminobenzamide |
| PubChem CID | 21217843 |
| Molecular Formula | C7H9N3O |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.07 |
| IUPAC Name | 3,4-diaminobenzamide |
| SMILES | NC(=O)c1ccc(N)c(N)c1 |
| InChI | InChI=1S/C7H9N3O/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3H,8-9H2,(H2,10,11) |
| InChIKey | RGJXMMUQTCONEI-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,4-diaminobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diaminobenzamide?
The IUPAC name of 3,4-diaminobenzamide (CID 21217843) is 3,4-diaminobenzamide.
What is the SMILES notation for 3,4-diaminobenzamide?
The canonical SMILES for 3,4-diaminobenzamide is NC(=O)c1ccc(N)c(N)c1.
What is the InChIKey of 3,4-diaminobenzamide?
The InChIKey is RGJXMMUQTCONEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3H,8-9H2,(H2,10,11).
What are the key properties of 3,4-diaminobenzamide?
3,4-diaminobenzamide has a molecular weight of 151.17 g/mol, XLogP of -0.05, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diaminobenzamide is sourced from PubChem (CID 21217843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).