C20H21F3N2O5 — CID 21217908
methyl 3-(3-carbamimidoylphenyl)-3-phenylmethoxypropanoate;2,2,2-trifluoroacetic acid (PubChem CID 21217908) has the molecular formula C20H21F3N2O5 and a molecular weight of 426.39 g/mol. Its IUPAC name is methyl 3-(3-carbamimidoylphenyl)-3-phenylmethoxypropanoate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl 3-(3-carbamimidoylphenyl)-3-phenylmethoxypropanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 21217908 |
| Molecular Formula | C20H21F3N2O5 |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | methyl 3-(3-carbamimidoylphenyl)-3-phenylmethoxypropanoate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1cccc(C(CC(=O)OC)OCc2ccccc2)c1 |
| InChI | InChI=1S/C18H20N2O3.C2HF3O2/c1-22-17(21)11-16(23-12-13-6-3-2-4-7-13)14-8-5-9-15(10-14)18(19)20;3-2(4,5)1(6)7/h2-10,16H,11-12H2,1H3,(H3,19,20);(H,6,7) |
| InChIKey | CXQHCQAFDLJTOQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 122.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|