C23H26F6N4O6 — CID 21217935
methyl 2-[N-[3-(4-aminophenyl)propyl]-3-carbamimidoylanilino]acetate;bis(2,2,2-trifluoroacetic acid) (PubChem CID 21217935) has the molecular formula C23H26F6N4O6 and a molecular weight of 568.47 g/mol. Its IUPAC name is methyl 2-[N-[3-(4-aminophenyl)propyl]-3-carbamimidoylanilino]acetate;bis(2,2,2-trifluoroacetic acid).
| Compound Name | methyl 2-[N-[3-(4-aminophenyl)propyl]-3-carbamimidoylanilino]acetate;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 21217935 |
| Molecular Formula | C23H26F6N4O6 |
| Molecular Weight | 568.47 g/mol |
| Exact Mass | 568.18 |
| IUPAC Name | methyl 2-[N-[3-(4-aminophenyl)propyl]-3-carbamimidoylanilino]acetate;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.[H]/N=C(\N)c1cccc(N(CCCc2ccc(N)cc2)CC(=O)OC)c1 |
| InChI | InChI=1S/C19H24N4O2.2C2HF3O2/c1-25-18(24)13-23(17-6-2-5-15(12-17)19(21)22)11-3-4-14-7-9-16(20)10-8-14;2*3-2(4,5)1(6)7/h2,5-10,12H,3-4,11,13,20H2,1H3,(H3,21,22);2*(H,6,7) |
| InChIKey | OHCLOPCQAJWVDM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 180.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|