C22H27F3N4O4 — CID 21217944
methyl 4-[N-[2-(4-aminophenyl)ethyl]-3-carbamimidoylanilino]butanoate;2,2,2-trifluoroacetic acid (PubChem CID 21217944) has the molecular formula C22H27F3N4O4 and a molecular weight of 468.48 g/mol. Its IUPAC name is methyl 4-[N-[2-(4-aminophenyl)ethyl]-3-carbamimidoylanilino]butanoate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl 4-[N-[2-(4-aminophenyl)ethyl]-3-carbamimidoylanilino]butanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 21217944 |
| Molecular Formula | C22H27F3N4O4 |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | methyl 4-[N-[2-(4-aminophenyl)ethyl]-3-carbamimidoylanilino]butanoate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1cccc(N(CCCC(=O)OC)CCc2ccc(N)cc2)c1 |
| InChI | InChI=1S/C20H26N4O2.C2HF3O2/c1-26-19(25)6-3-12-24(13-11-15-7-9-17(21)10-8-15)18-5-2-4-16(14-18)20(22)23;3-2(4,5)1(6)7/h2,4-5,7-10,14H,3,6,11-13,21H2,1H3,(H3,22,23);(H,6,7) |
| InChIKey | WOOQLAPSTSPWBW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 142.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|