C23H25F6N5O6 — CID 21217946
methyl 2-[3-carbamimidoyl-N-[2-(4-carbamimidoylphenyl)ethyl]anilino]acetate;bis(2,2,2-trifluoroacetic acid) (PubChem CID 21217946) has the molecular formula C23H25F6N5O6 and a molecular weight of 581.47 g/mol. Its IUPAC name is methyl 2-[3-carbamimidoyl-N-[2-(4-carbamimidoylphenyl)ethyl]anilino]acetate;bis(2,2,2-trifluoroacetic acid).
| Compound Name | methyl 2-[3-carbamimidoyl-N-[2-(4-carbamimidoylphenyl)ethyl]anilino]acetate;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 21217946 |
| Molecular Formula | C23H25F6N5O6 |
| Molecular Weight | 581.47 g/mol |
| Exact Mass | 581.17 |
| IUPAC Name | methyl 2-[3-carbamimidoyl-N-[2-(4-carbamimidoylphenyl)ethyl]anilino]acetate;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(CCN(CC(=O)OC)c2cccc(/C(N)=N/[H])c2)cc1 |
| InChI | InChI=1S/C19H23N5O2.2C2HF3O2/c1-26-17(25)12-24(16-4-2-3-15(11-16)19(22)23)10-9-13-5-7-14(8-6-13)18(20)21;2*3-2(4,5)1(6)7/h2-8,11H,9-10,12H2,1H3,(H3,20,21)(H3,22,23);2*(H,6,7) |
| InChIKey | ZRDCYMCYVFQWFT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 203.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|