C20H23F3N4O4 — CID 21217995
methyl 2-[N-[2-(4-aminophenyl)ethyl]-3-carbamimidoylanilino]acetate;2,2,2-trifluoroacetic acid (PubChem CID 21217995) has the molecular formula C20H23F3N4O4 and a molecular weight of 440.42 g/mol. Its IUPAC name is methyl 2-[N-[2-(4-aminophenyl)ethyl]-3-carbamimidoylanilino]acetate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl 2-[N-[2-(4-aminophenyl)ethyl]-3-carbamimidoylanilino]acetate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 21217995 |
| Molecular Formula | C20H23F3N4O4 |
| Molecular Weight | 440.42 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | methyl 2-[N-[2-(4-aminophenyl)ethyl]-3-carbamimidoylanilino]acetate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1cccc(N(CCc2ccc(N)cc2)CC(=O)OC)c1 |
| InChI | InChI=1S/C18H22N4O2.C2HF3O2/c1-24-17(23)12-22(10-9-13-5-7-15(19)8-6-13)16-4-2-3-14(11-16)18(20)21;3-2(4,5)1(6)7/h2-8,11H,9-10,12,19H2,1H3,(H3,20,21);(H,6,7) |
| InChIKey | BEDSWURFLQTXCN-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 142.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|