C23H29F3N4O4 — CID 21218001
ethyl 2-[N-[4-(4-aminophenyl)butyl]-3-carbamimidoylanilino]acetate;2,2,2-trifluoroacetic acid (PubChem CID 21218001) has the molecular formula C23H29F3N4O4 and a molecular weight of 482.50 g/mol. Its IUPAC name is ethyl 2-[N-[4-(4-aminophenyl)butyl]-3-carbamimidoylanilino]acetate;2,2,2-trifluoroacetic acid.
| Compound Name | ethyl 2-[N-[4-(4-aminophenyl)butyl]-3-carbamimidoylanilino]acetate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 21218001 |
| Molecular Formula | C23H29F3N4O4 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | ethyl 2-[N-[4-(4-aminophenyl)butyl]-3-carbamimidoylanilino]acetate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1cccc(N(CCCCc2ccc(N)cc2)CC(=O)OCC)c1 |
| InChI | InChI=1S/C21H28N4O2.C2HF3O2/c1-2-27-20(26)15-25(19-8-5-7-17(14-19)21(23)24)13-4-3-6-16-9-11-18(22)12-10-16;3-2(4,5)1(6)7/h5,7-12,14H,2-4,6,13,15,22H2,1H3,(H3,23,24);(H,6,7) |
| InChIKey | ACFAITFITFHYAH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 142.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|