C8H3BrN4 — CID 21218265
4-bromo-2,5-diiminocyclohexa-3,6-diene-1,3-dicarbonitrile (PubChem CID 21218265) has the molecular formula C8H3BrN4 and a molecular weight of 235.04 g/mol. Its IUPAC name is 4-bromo-2,5-diiminocyclohexa-3,6-diene-1,3-dicarbonitrile.
| Compound Name | 4-bromo-2,5-diiminocyclohexa-3,6-diene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 21218265 |
| Molecular Formula | C8H3BrN4 |
| Molecular Weight | 235.04 g/mol |
| Exact Mass | 233.95 |
| IUPAC Name | 4-bromo-2,5-diiminocyclohexa-3,6-diene-1,3-dicarbonitrile |
| SMILES | [H]/N=C1\C=C(C#N)/C(=N\[H])C(C#N)=C1Br |
| InChI | InChI=1S/C8H3BrN4/c9-7-5(3-11)8(13)4(2-10)1-6(7)12/h1,12-13H/b12-6+,13-8+ |
| InChIKey | JKMIKZGCBFHELT-XTUZQTQMSA-N |
| XLogP | 1.66 |
| TPSA | 95.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.04 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|