About 1,1-dipentylguanidine
1,1-dipentylguanidine (PubChem CID 21218368) has the molecular formula C11H25N3
and a molecular weight of 199.34 g/mol. Its IUPAC name is 1,1-dipentylguanidine.
Molecular Properties
| Compound Name | 1,1-dipentylguanidine |
| PubChem CID | 21218368 |
| Molecular Formula | C11H25N3 |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.20 |
| IUPAC Name | 1,1-dipentylguanidine |
| SMILES | [H]/N=C(\N)N(CCCCC)CCCCC |
| InChI | InChI=1S/C11H25N3/c1-3-5-7-9-14(11(12)13)10-8-6-4-2/h3-10H2,1-2H3,(H3,12,13) |
| InChIKey | SBFBPEVOKQRGSK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dipentylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dipentylguanidine?
The IUPAC name of 1,1-dipentylguanidine (CID 21218368) is 1,1-dipentylguanidine.
What is the SMILES notation for 1,1-dipentylguanidine?
The canonical SMILES for 1,1-dipentylguanidine is [H]/N=C(\N)N(CCCCC)CCCCC.
What is the InChIKey of 1,1-dipentylguanidine?
The InChIKey is SBFBPEVOKQRGSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25N3/c1-3-5-7-9-14(11(12)13)10-8-6-4-2/h3-10H2,1-2H3,(H3,12,13).
What are the key properties of 1,1-dipentylguanidine?
1,1-dipentylguanidine has a molecular weight of 199.34 g/mol, XLogP of 2.56, 8 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dipentylguanidine is sourced from PubChem (CID 21218368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).