C32H25ClF3N2O8P — CID 21218592
[4-chloro-2-[[2-oxo-5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-3-yl]methyl]phenyl] 2-bis(phenylmethoxy)phosphoryloxyacetate (PubChem CID 21218592) has the molecular formula C32H25ClF3N2O8P and a molecular weight of 688.98 g/mol. Its IUPAC name is [4-chloro-2-[[2-oxo-5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-3-yl]methyl]phenyl] 2-bis(phenylmethoxy)phosphoryloxyacetate.
| Compound Name | [4-chloro-2-[[2-oxo-5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-3-yl]methyl]phenyl] 2-bis(phenylmethoxy)phosphoryloxyacetate |
|---|---|
| PubChem CID | 21218592 |
| Molecular Formula | C32H25ClF3N2O8P |
| Molecular Weight | 688.98 g/mol |
| Exact Mass | 688.10 |
| IUPAC Name | [4-chloro-2-[[2-oxo-5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-3-yl]methyl]phenyl] 2-bis(phenylmethoxy)phosphoryloxyacetate |
| SMILES | O=C(COP(=O)(OCc1ccccc1)OCc1ccccc1)Oc1ccc(Cl)cc1Cn1nc(-c2ccc(C(F)(F)F)cc2)oc1=O |
| InChI | InChI=1S/C32H25ClF3N2O8P/c33-27-15-16-28(25(17-27)18-38-31(40)46-30(37-38)24-11-13-26(14-12-24)32(34,35)36)45-29(39)21-44-47(41,42-19-22-7-3-1-4-8-22)43-20-23-9-5-2-6-10-23/h1-17H,18-21H2 |
| InChIKey | OEIUZGXXBYGANW-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 119.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.98 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|