About N-ethyl-7H-purin-2-amine
N-ethyl-7H-purin-2-amine (PubChem CID 21218789) has the molecular formula C7H9N5
and a molecular weight of 163.18 g/mol. Its IUPAC name is N-ethyl-7H-purin-2-amine.
Molecular Properties
| Compound Name | N-ethyl-7H-purin-2-amine |
| PubChem CID | 21218789 |
| Molecular Formula | C7H9N5 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.09 |
| IUPAC Name | N-ethyl-7H-purin-2-amine |
| SMILES | CCNc1ncc2[nH]cnc2n1 |
| InChI | InChI=1S/C7H9N5/c1-2-8-7-9-3-5-6(12-7)11-4-10-5/h3-4H,2H2,1H3,(H2,8,9,10,11,12) |
| InChIKey | VTVXDZVCSHVLIS-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-ethyl-7H-purin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-7H-purin-2-amine?
The IUPAC name of N-ethyl-7H-purin-2-amine (CID 21218789) is N-ethyl-7H-purin-2-amine.
What is the SMILES notation for N-ethyl-7H-purin-2-amine?
The canonical SMILES for N-ethyl-7H-purin-2-amine is CCNc1ncc2[nH]cnc2n1.
What is the InChIKey of N-ethyl-7H-purin-2-amine?
The InChIKey is VTVXDZVCSHVLIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N5/c1-2-8-7-9-3-5-6(12-7)11-4-10-5/h3-4H,2H2,1H3,(H2,8,9,10,11,12).
What are the key properties of N-ethyl-7H-purin-2-amine?
N-ethyl-7H-purin-2-amine has a molecular weight of 163.18 g/mol, XLogP of 0.78, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-7H-purin-2-amine is sourced from PubChem (CID 21218789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).