C21H25NO4 — CID 21219403
methyl 2-(cyclopropylmethyl)-1,6-dioxo-4a-phenyl-4,5,7,8-tetrahydro-3H-isoquinoline-8a-carboxylate (PubChem CID 21219403) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is methyl 2-(cyclopropylmethyl)-1,6-dioxo-4a-phenyl-4,5,7,8-tetrahydro-3H-isoquinoline-8a-carboxylate.
| Compound Name | methyl 2-(cyclopropylmethyl)-1,6-dioxo-4a-phenyl-4,5,7,8-tetrahydro-3H-isoquinoline-8a-carboxylate |
|---|---|
| PubChem CID | 21219403 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | methyl 2-(cyclopropylmethyl)-1,6-dioxo-4a-phenyl-4,5,7,8-tetrahydro-3H-isoquinoline-8a-carboxylate |
| SMILES | COC(=O)C12CCC(=O)CC1(c1ccccc1)CCN(CC1CC1)C2=O |
| InChI | InChI=1S/C21H25NO4/c1-26-19(25)21-10-9-17(23)13-20(21,16-5-3-2-4-6-16)11-12-22(18(21)24)14-15-7-8-15/h2-6,15H,7-14H2,1H3 |
| InChIKey | HYWNICOMBREKKC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|