About (2-benzylsulfonyl-1,3-dihydroisoindol-5-yl)-tributylstannane
(2-benzylsulfonyl-1,3-dihydroisoindol-5-yl)-tributylstannane (PubChem CID 21220316) has the molecular formula C27H41NO2SSn
and a molecular weight of 562.41 g/mol. Its IUPAC name is (2-benzylsulfonyl-1,3-dihydroisoindol-5-yl)-tributylstannane.
Molecular Properties
| Compound Name | (2-benzylsulfonyl-1,3-dihydroisoindol-5-yl)-tributylstannane |
| PubChem CID | 21220316 |
| Molecular Formula | C27H41NO2SSn |
| Molecular Weight | 562.41 g/mol |
| Exact Mass | 563.19 |
| IUPAC Name | (2-benzylsulfonyl-1,3-dihydroisoindol-5-yl)-tributylstannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccc2c(c1)CN(S(=O)(=O)Cc1ccccc1)C2 |
| InChI | InChI=1S/C15H14NO2S.3C4H9.Sn/c17-19(18,12-13-6-2-1-3-7-13)16-10-14-8-4-5-9-15(14)11-16;3*1-3-4-2;/h1-4,6-9H,10-12H2;3*1,3-4H2,2H3; |
| InChIKey | GLVJMLZIYGZAQZ-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 562.41 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2-benzylsulfonyl-1,3-dihydroisoindol-5-yl)-tributylstannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-benzylsulfonyl-1,3-dihydroisoindol-5-yl)-tributylstannane?
The IUPAC name of (2-benzylsulfonyl-1,3-dihydroisoindol-5-yl)-tributylstannane (CID 21220316) is (2-benzylsulfonyl-1,3-dihydroisoindol-5-yl)-tributylstannane.
What is the SMILES notation for (2-benzylsulfonyl-1,3-dihydroisoindol-5-yl)-tributylstannane?
The canonical SMILES for (2-benzylsulfonyl-1,3-dihydroisoindol-5-yl)-tributylstannane is CCCC[Sn](CCCC)(CCCC)c1ccc2c(c1)CN(S(=O)(=O)Cc1ccccc1)C2.
What is the InChIKey of (2-benzylsulfonyl-1,3-dihydroisoindol-5-yl)-tributylstannane?
The InChIKey is GLVJMLZIYGZAQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14NO2S.3C4H9.Sn/c17-19(18,12-13-6-2-1-3-7-13)16-10-14-8-4-5-9-15(14)11-16;3*1-3-4-2;/h1-4,6-9H,10-12H2;3*1,3-4H2,2H3;.
What are the key properties of (2-benzylsulfonyl-1,3-dihydroisoindol-5-yl)-tributylstannane?
(2-benzylsulfonyl-1,3-dihydroisoindol-5-yl)-tributylstannane has a molecular weight of 562.41 g/mol, XLogP of 6.59, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-benzylsulfonyl-1,3-dihydroisoindol-5-yl)-tributylstannane is sourced from PubChem (CID 21220316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).