C16H17N5S — CID 21220776
14-[2-(dimethylamino)ethyl]-8-thia-3,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-10-amine (PubChem CID 21220776) has the molecular formula C16H17N5S and a molecular weight of 311.41 g/mol. Its IUPAC name is 14-[2-(dimethylamino)ethyl]-8-thia-3,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-10-amine.
| Compound Name | 14-[2-(dimethylamino)ethyl]-8-thia-3,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-10-amine |
|---|---|
| PubChem CID | 21220776 |
| Molecular Formula | C16H17N5S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 14-[2-(dimethylamino)ethyl]-8-thia-3,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-10-amine |
| SMILES | CN(C)CCn1nc2c3c(c(N)ccc31)Sc1cccnc1-2 |
| InChI | InChI=1S/C16H17N5S/c1-20(2)8-9-21-11-6-5-10(17)16-13(11)15(19-21)14-12(22-16)4-3-7-18-14/h3-7H,8-9,17H2,1-2H3 |
| InChIKey | GEBBDFPGCCSTEW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|