C17H20N6S — CID 21220779
N'-[14-(2-aminoethyl)-8-thia-6,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-10-yl]-N-methylethane-1,2-diamine (PubChem CID 21220779) has the molecular formula C17H20N6S and a molecular weight of 340.46 g/mol. Its IUPAC name is N'-[14-(2-aminoethyl)-8-thia-6,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-10-yl]-N-methylethane-1,2-diamine.
| Compound Name | N'-[14-(2-aminoethyl)-8-thia-6,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-10-yl]-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 21220779 |
| Molecular Formula | C17H20N6S |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | N'-[14-(2-aminoethyl)-8-thia-6,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-10-yl]-N-methylethane-1,2-diamine |
| SMILES | CNCCNc1ccc2c3c(nn2CCN)-c2cccnc2Sc13 |
| InChI | InChI=1S/C17H20N6S/c1-19-8-9-20-12-4-5-13-14-15(22-23(13)10-6-18)11-3-2-7-21-17(11)24-16(12)14/h2-5,7,19-20H,6,8-10,18H2,1H3 |
| InChIKey | VEJYGHSCRXITTR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 80.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|