About N-methyl-5-(trifluoromethyl)pyridin-3-amine;pyridine
N-methyl-5-(trifluoromethyl)pyridin-3-amine;pyridine (PubChem CID 21221267) has the molecular formula C12H12F3N3
and a molecular weight of 255.24 g/mol. Its IUPAC name is N-methyl-5-(trifluoromethyl)pyridin-3-amine;pyridine.
Molecular Properties
| Compound Name | N-methyl-5-(trifluoromethyl)pyridin-3-amine;pyridine |
| PubChem CID | 21221267 |
| Molecular Formula | C12H12F3N3 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | N-methyl-5-(trifluoromethyl)pyridin-3-amine;pyridine |
| SMILES | CNc1cncc(C(F)(F)F)c1.c1ccncc1 |
| InChI | InChI=1S/C7H7F3N2.C5H5N/c1-11-6-2-5(3-12-4-6)7(8,9)10;1-2-4-6-5-3-1/h2-4,11H,1H3;1-5H |
| InChIKey | BRVJNFCFAUXOLY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-5-(trifluoromethyl)pyridin-3-amine;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-5-(trifluoromethyl)pyridin-3-amine;pyridine?
The IUPAC name of N-methyl-5-(trifluoromethyl)pyridin-3-amine;pyridine (CID 21221267) is N-methyl-5-(trifluoromethyl)pyridin-3-amine;pyridine.
What is the SMILES notation for N-methyl-5-(trifluoromethyl)pyridin-3-amine;pyridine?
The canonical SMILES for N-methyl-5-(trifluoromethyl)pyridin-3-amine;pyridine is CNc1cncc(C(F)(F)F)c1.c1ccncc1.
What is the InChIKey of N-methyl-5-(trifluoromethyl)pyridin-3-amine;pyridine?
The InChIKey is BRVJNFCFAUXOLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F3N2.C5H5N/c1-11-6-2-5(3-12-4-6)7(8,9)10;1-2-4-6-5-3-1/h2-4,11H,1H3;1-5H.
What are the key properties of N-methyl-5-(trifluoromethyl)pyridin-3-amine;pyridine?
N-methyl-5-(trifluoromethyl)pyridin-3-amine;pyridine has a molecular weight of 255.24 g/mol, XLogP of 3.22, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-5-(trifluoromethyl)pyridin-3-amine;pyridine is sourced from PubChem (CID 21221267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).