About (E)-3-(3-bromo-4,5-dihydroxyphenyl)-2-[3-(trifluoromethyl)phenyl]sulfonylprop-2-enenitrile
(E)-3-(3-bromo-4,5-dihydroxyphenyl)-2-[3-(trifluoromethyl)phenyl]sulfonylprop-2-enenitrile (PubChem CID 21221747) has the molecular formula C16H9BrF3NO4S
and a molecular weight of 448.22 g/mol. Its IUPAC name is (E)-3-(3-bromo-4,5-dihydroxyphenyl)-2-[3-(trifluoromethyl)phenyl]sulfonylprop-2-enenitrile.
Molecular Properties
| Compound Name | (E)-3-(3-bromo-4,5-dihydroxyphenyl)-2-[3-(trifluoromethyl)phenyl]sulfonylprop-2-enenitrile |
| PubChem CID | 21221747 |
| Molecular Formula | C16H9BrF3NO4S |
| Molecular Weight | 448.22 g/mol |
| Exact Mass | 446.94 |
| IUPAC Name | (E)-3-(3-bromo-4,5-dihydroxyphenyl)-2-[3-(trifluoromethyl)phenyl]sulfonylprop-2-enenitrile |
| SMILES | N#C/C(=C\c1cc(O)c(O)c(Br)c1)S(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H9BrF3NO4S/c17-13-5-9(6-14(22)15(13)23)4-12(8-21)26(24,25)11-3-1-2-10(7-11)16(18,19)20/h1-7,22-23H/b12-4+ |
| InChIKey | UCQJAMBIRZBELC-UUILKARUSA-N |
| XLogP | 4.22 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.22 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(3-bromo-4,5-dihydroxyphenyl)-2-[3-(trifluoromethyl)phenyl]sulfonylprop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(3-bromo-4,5-dihydroxyphenyl)-2-[3-(trifluoromethyl)phenyl]sulfonylprop-2-enenitrile?
The IUPAC name of (E)-3-(3-bromo-4,5-dihydroxyphenyl)-2-[3-(trifluoromethyl)phenyl]sulfonylprop-2-enenitrile (CID 21221747) is (E)-3-(3-bromo-4,5-dihydroxyphenyl)-2-[3-(trifluoromethyl)phenyl]sulfonylprop-2-enenitrile.
What is the SMILES notation for (E)-3-(3-bromo-4,5-dihydroxyphenyl)-2-[3-(trifluoromethyl)phenyl]sulfonylprop-2-enenitrile?
The canonical SMILES for (E)-3-(3-bromo-4,5-dihydroxyphenyl)-2-[3-(trifluoromethyl)phenyl]sulfonylprop-2-enenitrile is N#C/C(=C\c1cc(O)c(O)c(Br)c1)S(=O)(=O)c1cccc(C(F)(F)F)c1.
What is the InChIKey of (E)-3-(3-bromo-4,5-dihydroxyphenyl)-2-[3-(trifluoromethyl)phenyl]sulfonylprop-2-enenitrile?
The InChIKey is UCQJAMBIRZBELC-UUILKARUSA-N. The full InChI is InChI=1S/C16H9BrF3NO4S/c17-13-5-9(6-14(22)15(13)23)4-12(8-21)26(24,25)11-3-1-2-10(7-11)16(18,19)20/h1-7,22-23H/b12-4+.
What are the key properties of (E)-3-(3-bromo-4,5-dihydroxyphenyl)-2-[3-(trifluoromethyl)phenyl]sulfonylprop-2-enenitrile?
(E)-3-(3-bromo-4,5-dihydroxyphenyl)-2-[3-(trifluoromethyl)phenyl]sulfonylprop-2-enenitrile has a molecular weight of 448.22 g/mol, XLogP of 4.22, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(3-bromo-4,5-dihydroxyphenyl)-2-[3-(trifluoromethyl)phenyl]sulfonylprop-2-enenitrile is sourced from PubChem (CID 21221747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).