C13H19N5 — CID 21221887
6-(7-propan-2-yl-2-bicyclo[2.2.1]hept-5-enyl)-1,3,5-triazine-2,4-diamine (PubChem CID 21221887) has the molecular formula C13H19N5 and a molecular weight of 245.33 g/mol. Its IUPAC name is 6-(7-propan-2-yl-2-bicyclo[2.2.1]hept-5-enyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(7-propan-2-yl-2-bicyclo[2.2.1]hept-5-enyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 21221887 |
| Molecular Formula | C13H19N5 |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | 6-(7-propan-2-yl-2-bicyclo[2.2.1]hept-5-enyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC(C)C1C2C=CC1C(c1nc(N)nc(N)n1)C2 |
| InChI | InChI=1S/C13H19N5/c1-6(2)10-7-3-4-8(10)9(5-7)11-16-12(14)18-13(15)17-11/h3-4,6-10H,5H2,1-2H3,(H4,14,15,16,17,18) |
| InChIKey | AEJBGTREAFVHEJ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|