C11H15N5 — CID 21221890
6-(3-methyl-2-bicyclo[2.2.1]hept-5-enyl)-1,3,5-triazine-2,4-diamine (PubChem CID 21221890) has the molecular formula C11H15N5 and a molecular weight of 217.28 g/mol. Its IUPAC name is 6-(3-methyl-2-bicyclo[2.2.1]hept-5-enyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(3-methyl-2-bicyclo[2.2.1]hept-5-enyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 21221890 |
| Molecular Formula | C11H15N5 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 6-(3-methyl-2-bicyclo[2.2.1]hept-5-enyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC1C2C=CC(C2)C1c1nc(N)nc(N)n1 |
| InChI | InChI=1S/C11H15N5/c1-5-6-2-3-7(4-6)8(5)9-14-10(12)16-11(13)15-9/h2-3,5-8H,4H2,1H3,(H4,12,13,14,15,16) |
| InChIKey | KEIMVOBPJCTFCZ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|