About 1-propylcyclohexa-2,4-diene-1-carboxylic acid
1-propylcyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 21221967) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is 1-propylcyclohexa-2,4-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-propylcyclohexa-2,4-diene-1-carboxylic acid |
| PubChem CID | 21221967 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 1-propylcyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | CCCC1(C(=O)O)C=CC=CC1 |
| InChI | InChI=1S/C10H14O2/c1-2-6-10(9(11)12)7-4-3-5-8-10/h3-5,7H,2,6,8H2,1H3,(H,11,12) |
| InChIKey | RHRYVHICRLKJDI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-propylcyclohexa-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propylcyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 1-propylcyclohexa-2,4-diene-1-carboxylic acid (CID 21221967) is 1-propylcyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 1-propylcyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 1-propylcyclohexa-2,4-diene-1-carboxylic acid is CCCC1(C(=O)O)C=CC=CC1.
What is the InChIKey of 1-propylcyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is RHRYVHICRLKJDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2/c1-2-6-10(9(11)12)7-4-3-5-8-10/h3-5,7H,2,6,8H2,1H3,(H,11,12).
What are the key properties of 1-propylcyclohexa-2,4-diene-1-carboxylic acid?
1-propylcyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 166.22 g/mol, XLogP of 2.37, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propylcyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 21221967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).