C19H15NO5 — CID 21222
5-hydroxy-4,15,16-trimethoxy-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaen-8-one (PubChem CID 21222) has the molecular formula C19H15NO5 and a molecular weight of 337.33 g/mol. Its IUPAC name is 5-hydroxy-4,15,16-trimethoxy-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaen-8-one.
| Compound Name | 5-hydroxy-4,15,16-trimethoxy-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaen-8-one |
|---|---|
| PubChem CID | 21222 |
| Molecular Formula | C19H15NO5 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 5-hydroxy-4,15,16-trimethoxy-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaen-8-one |
| SMILES | COc1cc2c(cc1O)C(=O)c1nccc3cc(OC)c(OC)c-2c13 |
| InChI | InChI=1S/C19H15NO5/c1-23-13-8-10-11(7-12(13)21)18(22)17-15-9(4-5-20-17)6-14(24-2)19(25-3)16(10)15/h4-8,21H,1-3H3 |
| InChIKey | VITQCDLNBVTCJS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |