About [3-[4,4-di(propan-2-yl)-3-propan-2-yloxydioxetan-3-yl]phenyl] dihydrogen phosphate
[3-[4,4-di(propan-2-yl)-3-propan-2-yloxydioxetan-3-yl]phenyl] dihydrogen phosphate (PubChem CID 21222769) has the molecular formula C17H27O7P
and a molecular weight of 374.37 g/mol. Its IUPAC name is [3-[4,4-di(propan-2-yl)-3-propan-2-yloxydioxetan-3-yl]phenyl] dihydrogen phosphate.
Molecular Properties
| Compound Name | [3-[4,4-di(propan-2-yl)-3-propan-2-yloxydioxetan-3-yl]phenyl] dihydrogen phosphate |
| PubChem CID | 21222769 |
| Molecular Formula | C17H27O7P |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | [3-[4,4-di(propan-2-yl)-3-propan-2-yloxydioxetan-3-yl]phenyl] dihydrogen phosphate |
| SMILES | CC(C)OC1(c2cccc(OP(=O)(O)O)c2)OOC1(C(C)C)C(C)C |
| InChI | InChI=1S/C17H27O7P/c1-11(2)16(12(3)4)17(24-23-16,21-13(5)6)14-8-7-9-15(10-14)22-25(18,19)20/h7-13H,1-6H3,(H2,18,19,20) |
| InChIKey | RMQASHLCDJSMEQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [3-[4,4-di(propan-2-yl)-3-propan-2-yloxydioxetan-3-yl]phenyl] dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[4,4-di(propan-2-yl)-3-propan-2-yloxydioxetan-3-yl]phenyl] dihydrogen phosphate?
The IUPAC name of [3-[4,4-di(propan-2-yl)-3-propan-2-yloxydioxetan-3-yl]phenyl] dihydrogen phosphate (CID 21222769) is [3-[4,4-di(propan-2-yl)-3-propan-2-yloxydioxetan-3-yl]phenyl] dihydrogen phosphate.
What is the SMILES notation for [3-[4,4-di(propan-2-yl)-3-propan-2-yloxydioxetan-3-yl]phenyl] dihydrogen phosphate?
The canonical SMILES for [3-[4,4-di(propan-2-yl)-3-propan-2-yloxydioxetan-3-yl]phenyl] dihydrogen phosphate is CC(C)OC1(c2cccc(OP(=O)(O)O)c2)OOC1(C(C)C)C(C)C.
What is the InChIKey of [3-[4,4-di(propan-2-yl)-3-propan-2-yloxydioxetan-3-yl]phenyl] dihydrogen phosphate?
The InChIKey is RMQASHLCDJSMEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27O7P/c1-11(2)16(12(3)4)17(24-23-16,21-13(5)6)14-8-7-9-15(10-14)22-25(18,19)20/h7-13H,1-6H3,(H2,18,19,20).
What are the key properties of [3-[4,4-di(propan-2-yl)-3-propan-2-yloxydioxetan-3-yl]phenyl] dihydrogen phosphate?
[3-[4,4-di(propan-2-yl)-3-propan-2-yloxydioxetan-3-yl]phenyl] dihydrogen phosphate has a molecular weight of 374.37 g/mol, XLogP of 3.75, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[4,4-di(propan-2-yl)-3-propan-2-yloxydioxetan-3-yl]phenyl] dihydrogen phosphate is sourced from PubChem (CID 21222769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).