About 1H-pyrazole-4,5-diamine;dihydrochloride
1H-pyrazole-4,5-diamine;dihydrochloride (PubChem CID 21222877) has the molecular formula C3H8Cl2N4
and a molecular weight of 171.03 g/mol. Its IUPAC name is 1H-pyrazole-4,5-diamine;dihydrochloride.
Molecular Properties
| Compound Name | 1H-pyrazole-4,5-diamine;dihydrochloride |
| PubChem CID | 21222877 |
| Molecular Formula | C3H8Cl2N4 |
| Molecular Weight | 171.03 g/mol |
| Exact Mass | 170.01 |
| IUPAC Name | 1H-pyrazole-4,5-diamine;dihydrochloride |
| SMILES | Cl.Cl.Nc1cn[nH]c1N |
| InChI | InChI=1S/C3H6N4.2ClH/c4-2-1-6-7-3(2)5;;/h1H,4H2,(H3,5,6,7);2*1H |
| InChIKey | LDWUEWGGIOHZSR-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.03 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-pyrazole-4,5-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrazole-4,5-diamine;dihydrochloride?
The IUPAC name of 1H-pyrazole-4,5-diamine;dihydrochloride (CID 21222877) is 1H-pyrazole-4,5-diamine;dihydrochloride.
What is the SMILES notation for 1H-pyrazole-4,5-diamine;dihydrochloride?
The canonical SMILES for 1H-pyrazole-4,5-diamine;dihydrochloride is Cl.Cl.Nc1cn[nH]c1N.
What is the InChIKey of 1H-pyrazole-4,5-diamine;dihydrochloride?
The InChIKey is LDWUEWGGIOHZSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N4.2ClH/c4-2-1-6-7-3(2)5;;/h1H,4H2,(H3,5,6,7);2*1H.
What are the key properties of 1H-pyrazole-4,5-diamine;dihydrochloride?
1H-pyrazole-4,5-diamine;dihydrochloride has a molecular weight of 171.03 g/mol, XLogP of 0.42, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrazole-4,5-diamine;dihydrochloride is sourced from PubChem (CID 21222877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).