About 2,6-difluorocyclohexa-1,3-diene-1,3,5-tricarbonitrile
2,6-difluorocyclohexa-1,3-diene-1,3,5-tricarbonitrile (PubChem CID 21223087) has the molecular formula C9H3F2N3
and a molecular weight of 191.14 g/mol. Its IUPAC name is 2,6-difluorocyclohexa-1,3-diene-1,3,5-tricarbonitrile.
Analyze 2,6-difluorocyclohexa-1,3-diene-1,3,5-tricarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-difluorocyclohexa-1,3-diene-1,3,5-tricarbonitrile?
The IUPAC name of 2,6-difluorocyclohexa-1,3-diene-1,3,5-tricarbonitrile (CID 21223087) is 2,6-difluorocyclohexa-1,3-diene-1,3,5-tricarbonitrile.
What is the SMILES notation for 2,6-difluorocyclohexa-1,3-diene-1,3,5-tricarbonitrile?
The canonical SMILES for 2,6-difluorocyclohexa-1,3-diene-1,3,5-tricarbonitrile is N#CC1=CC(C#N)C(F)C(C#N)=C1F.
What is the InChIKey of 2,6-difluorocyclohexa-1,3-diene-1,3,5-tricarbonitrile?
The InChIKey is YQTNAJXLNSRLFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H3F2N3/c10-8-5(2-12)1-6(3-13)9(11)7(8)4-14/h1,5,8H.
What are the key properties of 2,6-difluorocyclohexa-1,3-diene-1,3,5-tricarbonitrile?
2,6-difluorocyclohexa-1,3-diene-1,3,5-tricarbonitrile has a molecular weight of 191.14 g/mol, XLogP of 1.68, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-difluorocyclohexa-1,3-diene-1,3,5-tricarbonitrile is sourced from PubChem (CID 21223087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).