C10H16F6N4O2 — CID 21223133
N-[2-[2-(2-aminoethylamino)ethylamino]ethyl]-2,2,2-trifluoro-N-(2,2,2-trifluoroacetyl)acetamide (PubChem CID 21223133) has the molecular formula C10H16F6N4O2 and a molecular weight of 338.25 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethylamino)ethylamino]ethyl]-2,2,2-trifluoro-N-(2,2,2-trifluoroacetyl)acetamide.
| Compound Name | N-[2-[2-(2-aminoethylamino)ethylamino]ethyl]-2,2,2-trifluoro-N-(2,2,2-trifluoroacetyl)acetamide |
|---|---|
| PubChem CID | 21223133 |
| Molecular Formula | C10H16F6N4O2 |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | N-[2-[2-(2-aminoethylamino)ethylamino]ethyl]-2,2,2-trifluoro-N-(2,2,2-trifluoroacetyl)acetamide |
| SMILES | NCCNCCNCCN(C(=O)C(F)(F)F)C(=O)C(F)(F)F |
| InChI | InChI=1S/C10H16F6N4O2/c11-9(12,13)7(21)20(8(22)10(14,15)16)6-5-19-4-3-18-2-1-17/h18-19H,1-6,17H2 |
| InChIKey | LERNJJODFYBJTA-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|