About 2-(2-hydroxypropoxy)propan-1-ol;2-methylpentane-1,3-diol
2-(2-hydroxypropoxy)propan-1-ol;2-methylpentane-1,3-diol (PubChem CID 21223163) has the molecular formula C12H28O5
and a molecular weight of 252.35 g/mol. Its IUPAC name is 2-(2-hydroxypropoxy)propan-1-ol;2-methylpentane-1,3-diol.
Molecular Properties
| Compound Name | 2-(2-hydroxypropoxy)propan-1-ol;2-methylpentane-1,3-diol |
| PubChem CID | 21223163 |
| Molecular Formula | C12H28O5 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | 2-(2-hydroxypropoxy)propan-1-ol;2-methylpentane-1,3-diol |
| SMILES | CC(O)COC(C)CO.CCC(O)C(C)CO |
| InChI | InChI=1S/C6H14O3.C6H14O2/c1-5(8)4-9-6(2)3-7;1-3-6(8)5(2)4-7/h5-8H,3-4H2,1-2H3;5-8H,3-4H2,1-2H3 |
| InChIKey | PFMKGHGARLMCBD-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2-hydroxypropoxy)propan-1-ol;2-methylpentane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxypropoxy)propan-1-ol;2-methylpentane-1,3-diol?
The IUPAC name of 2-(2-hydroxypropoxy)propan-1-ol;2-methylpentane-1,3-diol (CID 21223163) is 2-(2-hydroxypropoxy)propan-1-ol;2-methylpentane-1,3-diol.
What is the SMILES notation for 2-(2-hydroxypropoxy)propan-1-ol;2-methylpentane-1,3-diol?
The canonical SMILES for 2-(2-hydroxypropoxy)propan-1-ol;2-methylpentane-1,3-diol is CC(O)COC(C)CO.CCC(O)C(C)CO.
What is the InChIKey of 2-(2-hydroxypropoxy)propan-1-ol;2-methylpentane-1,3-diol?
The InChIKey is PFMKGHGARLMCBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O3.C6H14O2/c1-5(8)4-9-6(2)3-7;1-3-6(8)5(2)4-7/h5-8H,3-4H2,1-2H3;5-8H,3-4H2,1-2H3.
What are the key properties of 2-(2-hydroxypropoxy)propan-1-ol;2-methylpentane-1,3-diol?
2-(2-hydroxypropoxy)propan-1-ol;2-methylpentane-1,3-diol has a molecular weight of 252.35 g/mol, XLogP of 0.15, 7 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxypropoxy)propan-1-ol;2-methylpentane-1,3-diol is sourced from PubChem (CID 21223163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).