About (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) hydrogen carbonate
(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) hydrogen carbonate (PubChem CID 21223258) has the molecular formula C5H6NO6+
and a molecular weight of 176.10 g/mol. Its IUPAC name is (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) hydrogen carbonate.
Molecular Properties
| Compound Name | (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) hydrogen carbonate |
| PubChem CID | 21223258 |
| Molecular Formula | C5H6NO6+ |
| Molecular Weight | 176.10 g/mol |
| Exact Mass | 176.02 |
| IUPAC Name | (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) hydrogen carbonate |
| SMILES | O=C(O)O[N+]1(O)C(=O)CCC1=O |
| InChI | InChI=1S/C5H5NO6/c7-3-1-2-4(8)6(3,11)12-5(9)10/h11H,1-2H2/p+1 |
| InChIKey | OBMOREJOYASGPJ-UHFFFAOYSA-O |
| XLogP | -0.35 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.10 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) hydrogen carbonate?
The IUPAC name of (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) hydrogen carbonate (CID 21223258) is (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) hydrogen carbonate.
What is the SMILES notation for (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) hydrogen carbonate?
The canonical SMILES for (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) hydrogen carbonate is O=C(O)O[N+]1(O)C(=O)CCC1=O.
What is the InChIKey of (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) hydrogen carbonate?
The InChIKey is OBMOREJOYASGPJ-UHFFFAOYSA-O. The full InChI is InChI=1S/C5H5NO6/c7-3-1-2-4(8)6(3,11)12-5(9)10/h11H,1-2H2/p+1.
What are the key properties of (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) hydrogen carbonate?
(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) hydrogen carbonate has a molecular weight of 176.10 g/mol, XLogP of -0.35, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) hydrogen carbonate is sourced from PubChem (CID 21223258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).