C37H41Cl2F6N5O — CID 21223576
N-[2-(3,4-dichlorophenyl)-4-[4-(1-pentylbenzimidazol-2-yl)-1,4-diazepan-1-yl]butyl]-N-methyl-3,5-bis(trifluoromethyl)benzamide (PubChem CID 21223576) has the molecular formula C37H41Cl2F6N5O and a molecular weight of 756.66 g/mol. Its IUPAC name is N-[2-(3,4-dichlorophenyl)-4-[4-(1-pentylbenzimidazol-2-yl)-1,4-diazepan-1-yl]butyl]-N-methyl-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[2-(3,4-dichlorophenyl)-4-[4-(1-pentylbenzimidazol-2-yl)-1,4-diazepan-1-yl]butyl]-N-methyl-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 21223576 |
| Molecular Formula | C37H41Cl2F6N5O |
| Molecular Weight | 756.66 g/mol |
| Exact Mass | 755.26 |
| IUPAC Name | N-[2-(3,4-dichlorophenyl)-4-[4-(1-pentylbenzimidazol-2-yl)-1,4-diazepan-1-yl]butyl]-N-methyl-3,5-bis(trifluoromethyl)benzamide |
| SMILES | CCCCCn1c(N2CCCN(CCC(CN(C)C(=O)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c3ccc(Cl)c(Cl)c3)CC2)nc2ccccc21 |
| InChI | InChI=1S/C37H41Cl2F6N5O/c1-3-4-7-16-50-33-10-6-5-9-32(33)46-35(50)49-15-8-14-48(18-19-49)17-13-26(25-11-12-30(38)31(39)22-25)24-47(2)34(51)27-20-28(36(40,41)42)23-29(21-27)37(43,44)45/h5-6,9-12,20-23,26H,3-4,7-8,13-19,24H2,1-2H3 |
| InChIKey | UACLROHTZWPGKZ-UHFFFAOYSA-N |
| XLogP | 10.03 |
| TPSA | 44.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.66 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|