About bis(piperidine);urea
bis(piperidine);urea (PubChem CID 21223922) has the molecular formula C11H26N4O
and a molecular weight of 230.36 g/mol. Its IUPAC name is bis(piperidine);urea.
Molecular Properties
| Compound Name | bis(piperidine);urea |
| PubChem CID | 21223922 |
| Molecular Formula | C11H26N4O |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.21 |
| IUPAC Name | bis(piperidine);urea |
| SMILES | C1CCNCC1.C1CCNCC1.NC(N)=O |
| InChI | InChI=1S/2C5H11N.CH4N2O/c2*1-2-4-6-5-3-1;2-1(3)4/h2*6H,1-5H2;(H4,2,3,4) |
| InChIKey | QICRRCVRQJDEJK-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze bis(piperidine);urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(piperidine);urea?
The IUPAC name of bis(piperidine);urea (CID 21223922) is bis(piperidine);urea.
What is the SMILES notation for bis(piperidine);urea?
The canonical SMILES for bis(piperidine);urea is C1CCNCC1.C1CCNCC1.NC(N)=O.
What is the InChIKey of bis(piperidine);urea?
The InChIKey is QICRRCVRQJDEJK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H11N.CH4N2O/c2*1-2-4-6-5-3-1;2-1(3)4/h2*6H,1-5H2;(H4,2,3,4).
What are the key properties of bis(piperidine);urea?
bis(piperidine);urea has a molecular weight of 230.36 g/mol, XLogP of 0.54, 0 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(piperidine);urea is sourced from PubChem (CID 21223922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).