C22H21NO4S — CID 21224275
bicyclo[2.2.1]hepta-1,3,5-triene;N-hydroxy-3-(4-phenylphenyl)sulfonylpropanamide (PubChem CID 21224275) has the molecular formula C22H21NO4S and a molecular weight of 395.48 g/mol. Its IUPAC name is bicyclo[2.2.1]hepta-1,3,5-triene;N-hydroxy-3-(4-phenylphenyl)sulfonylpropanamide.
| Compound Name | bicyclo[2.2.1]hepta-1,3,5-triene;N-hydroxy-3-(4-phenylphenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 21224275 |
| Molecular Formula | C22H21NO4S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | bicyclo[2.2.1]hepta-1,3,5-triene;N-hydroxy-3-(4-phenylphenyl)sulfonylpropanamide |
| SMILES | C1=CC2=CC=C1C2.O=C(CCS(=O)(=O)c1ccc(-c2ccccc2)cc1)NO |
| InChI | InChI=1S/C15H15NO4S.C7H6/c17-15(16-18)10-11-21(19,20)14-8-6-13(7-9-14)12-4-2-1-3-5-12;1-2-7-4-3-6(1)5-7/h1-9,18H,10-11H2,(H,16,17);1-4H,5H2 |
| InChIKey | MQUHUOORZUKGPE-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|