C17H19NO4S — CID 21224383
2-benzyl-N-hydroxy-3-(4-methoxyphenyl)sulfinylpropanamide (PubChem CID 21224383) has the molecular formula C17H19NO4S and a molecular weight of 333.41 g/mol. Its IUPAC name is 2-benzyl-N-hydroxy-3-(4-methoxyphenyl)sulfinylpropanamide.
| Compound Name | 2-benzyl-N-hydroxy-3-(4-methoxyphenyl)sulfinylpropanamide |
|---|---|
| PubChem CID | 21224383 |
| Molecular Formula | C17H19NO4S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 2-benzyl-N-hydroxy-3-(4-methoxyphenyl)sulfinylpropanamide |
| SMILES | COc1ccc(S(=O)CC(Cc2ccccc2)C(=O)NO)cc1 |
| InChI | InChI=1S/C17H19NO4S/c1-22-15-7-9-16(10-8-15)23(21)12-14(17(19)18-20)11-13-5-3-2-4-6-13/h2-10,14,20H,11-12H2,1H3,(H,18,19) |
| InChIKey | HMZVWPOQHCAIDG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|