About 1-morpholin-4-ylethyl 2-methylprop-2-enoate;hydrofluoride
1-morpholin-4-ylethyl 2-methylprop-2-enoate;hydrofluoride (PubChem CID 21224570) has the molecular formula C10H18FNO3
and a molecular weight of 219.26 g/mol. Its IUPAC name is 1-morpholin-4-ylethyl 2-methylprop-2-enoate;hydrofluoride.
Molecular Properties
| Compound Name | 1-morpholin-4-ylethyl 2-methylprop-2-enoate;hydrofluoride |
| PubChem CID | 21224570 |
| Molecular Formula | C10H18FNO3 |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 1-morpholin-4-ylethyl 2-methylprop-2-enoate;hydrofluoride |
| SMILES | C=C(C)C(=O)OC(C)N1CCOCC1.F |
| InChI | InChI=1S/C10H17NO3.FH/c1-8(2)10(12)14-9(3)11-4-6-13-7-5-11;/h9H,1,4-7H2,2-3H3;1H |
| InChIKey | WYMUHJSPRPAPLP-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-morpholin-4-ylethyl 2-methylprop-2-enoate;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-morpholin-4-ylethyl 2-methylprop-2-enoate;hydrofluoride?
The IUPAC name of 1-morpholin-4-ylethyl 2-methylprop-2-enoate;hydrofluoride (CID 21224570) is 1-morpholin-4-ylethyl 2-methylprop-2-enoate;hydrofluoride.
What is the SMILES notation for 1-morpholin-4-ylethyl 2-methylprop-2-enoate;hydrofluoride?
The canonical SMILES for 1-morpholin-4-ylethyl 2-methylprop-2-enoate;hydrofluoride is C=C(C)C(=O)OC(C)N1CCOCC1.F.
What is the InChIKey of 1-morpholin-4-ylethyl 2-methylprop-2-enoate;hydrofluoride?
The InChIKey is WYMUHJSPRPAPLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO3.FH/c1-8(2)10(12)14-9(3)11-4-6-13-7-5-11;/h9H,1,4-7H2,2-3H3;1H.
What are the key properties of 1-morpholin-4-ylethyl 2-methylprop-2-enoate;hydrofluoride?
1-morpholin-4-ylethyl 2-methylprop-2-enoate;hydrofluoride has a molecular weight of 219.26 g/mol, XLogP of 0.94, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-morpholin-4-ylethyl 2-methylprop-2-enoate;hydrofluoride is sourced from PubChem (CID 21224570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).