About methylazanium;4-octyl-1-azabicyclo[2.2.2]octane;chloride
methylazanium;4-octyl-1-azabicyclo[2.2.2]octane;chloride (PubChem CID 21224613) has the molecular formula C16H35ClN2
and a molecular weight of 290.92 g/mol. Its IUPAC name is methylazanium;4-octyl-1-azabicyclo[2.2.2]octane;chloride.
Molecular Properties
| Compound Name | methylazanium;4-octyl-1-azabicyclo[2.2.2]octane;chloride |
| PubChem CID | 21224613 |
| Molecular Formula | C16H35ClN2 |
| Molecular Weight | 290.92 g/mol |
| Exact Mass | 290.25 |
| IUPAC Name | methylazanium;4-octyl-1-azabicyclo[2.2.2]octane;chloride |
| SMILES | CCCCCCCCC12CCN(CC1)CC2.C[NH3+].[Cl-] |
| InChI | InChI=1S/C15H29N.CH5N.ClH/c1-2-3-4-5-6-7-8-15-9-12-16(13-10-15)14-11-15;1-2;/h2-14H2,1H3;2H2,1H3;1H |
| InChIKey | BVVYDZOJTWAKIQ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 30.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.92 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methylazanium;4-octyl-1-azabicyclo[2.2.2]octane;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylazanium;4-octyl-1-azabicyclo[2.2.2]octane;chloride?
The IUPAC name of methylazanium;4-octyl-1-azabicyclo[2.2.2]octane;chloride (CID 21224613) is methylazanium;4-octyl-1-azabicyclo[2.2.2]octane;chloride.
What is the SMILES notation for methylazanium;4-octyl-1-azabicyclo[2.2.2]octane;chloride?
The canonical SMILES for methylazanium;4-octyl-1-azabicyclo[2.2.2]octane;chloride is CCCCCCCCC12CCN(CC1)CC2.C[NH3+].[Cl-].
What is the InChIKey of methylazanium;4-octyl-1-azabicyclo[2.2.2]octane;chloride?
The InChIKey is BVVYDZOJTWAKIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29N.CH5N.ClH/c1-2-3-4-5-6-7-8-15-9-12-16(13-10-15)14-11-15;1-2;/h2-14H2,1H3;2H2,1H3;1H.
What are the key properties of methylazanium;4-octyl-1-azabicyclo[2.2.2]octane;chloride?
methylazanium;4-octyl-1-azabicyclo[2.2.2]octane;chloride has a molecular weight of 290.92 g/mol, XLogP of 0.09, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methylazanium;4-octyl-1-azabicyclo[2.2.2]octane;chloride is sourced from PubChem (CID 21224613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).