C40H36N2O6 — CID 21224627
1-[2-[4-[1-[4-[2-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]-2-ethylhexyl]phenoxy]phenyl]pyrrole-2,5-dione (PubChem CID 21224627) has the molecular formula C40H36N2O6 and a molecular weight of 640.74 g/mol. Its IUPAC name is 1-[2-[4-[1-[4-[2-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]-2-ethylhexyl]phenoxy]phenyl]pyrrole-2,5-dione.
| Compound Name | 1-[2-[4-[1-[4-[2-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]-2-ethylhexyl]phenoxy]phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 21224627 |
| Molecular Formula | C40H36N2O6 |
| Molecular Weight | 640.74 g/mol |
| Exact Mass | 640.26 |
| IUPAC Name | 1-[2-[4-[1-[4-[2-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]-2-ethylhexyl]phenoxy]phenyl]pyrrole-2,5-dione |
| SMILES | CCCCC(CC)C(c1ccc(Oc2ccccc2N2C(=O)C=CC2=O)cc1)c1ccc(Oc2ccccc2N2C(=O)C=CC2=O)cc1 |
| InChI | InChI=1S/C40H36N2O6/c1-3-5-10-27(4-2)40(28-15-19-30(20-16-28)47-34-13-8-6-11-32(34)41-36(43)23-24-37(41)44)29-17-21-31(22-18-29)48-35-14-9-7-12-33(35)42-38(45)25-26-39(42)46/h6-9,11-27,40H,3-5,10H2,1-2H3 |
| InChIKey | MCWCKOQZOCSTAG-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.74 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|