About 3-cyclohexylcyclohexyne
3-cyclohexylcyclohexyne (PubChem CID 21224652) has the molecular formula C12H18
and a molecular weight of 162.28 g/mol. Its IUPAC name is 3-cyclohexylcyclohexyne.
Molecular Properties
| Compound Name | 3-cyclohexylcyclohexyne |
| PubChem CID | 21224652 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | 3-cyclohexylcyclohexyne |
| SMILES | C1#CC(C2CCCCC2)CCC1 |
| InChI | InChI=1S/C12H18/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h11-12H,1-5,7-9H2 |
| InChIKey | PDGRLIZTJNCFIP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclohexylcyclohexyne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexylcyclohexyne?
The IUPAC name of 3-cyclohexylcyclohexyne (CID 21224652) is 3-cyclohexylcyclohexyne.
What is the SMILES notation for 3-cyclohexylcyclohexyne?
The canonical SMILES for 3-cyclohexylcyclohexyne is C1#CC(C2CCCCC2)CCC1.
What is the InChIKey of 3-cyclohexylcyclohexyne?
The InChIKey is PDGRLIZTJNCFIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h11-12H,1-5,7-9H2.
What are the key properties of 3-cyclohexylcyclohexyne?
3-cyclohexylcyclohexyne has a molecular weight of 162.28 g/mol, XLogP of 3.37, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexylcyclohexyne is sourced from PubChem (CID 21224652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).